Difference between revisions of "L-arginyl-3-sulfo-L-alaninyl-Peptides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BETA-L-ARABINOSE == * common-name: ** β-l-arabinopyranose * smiles: ** c1(c(c(c(c(o1)o)o)o)o) * inchi-key: ** srbfzhdqgsbbor-klvwxmo...")
(Created page with "Category:metabolite == Metabolite XTP == * common-name: ** xtp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BETA-L-ARABINOSE ==
+
== Metabolite XTP ==
 
* common-name:
 
* common-name:
** β-l-arabinopyranose
+
** xtp
 
* smiles:
 
* smiles:
** c1(c(c(c(c(o1)o)o)o)o)
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 
* inchi-key:
 
* inchi-key:
** srbfzhdqgsbbor-klvwxmoxsa-n
+
** caefewvyezabla-uuokfmhzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 150.131
+
** 520.136
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[NTPD]]
 +
* [[RXN0-1603]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BETA-L-ARABINOSIDASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-l-arabinopyranose}}
+
{{#set: common-name=xtp}}
{{#set: inchi-key=inchikey=srbfzhdqgsbbor-klvwxmoxsa-n}}
+
{{#set: inchi-key=inchikey=caefewvyezabla-uuokfmhzsa-j}}
{{#set: molecular-weight=150.131}}
+
{{#set: molecular-weight=520.136}}

Revision as of 08:26, 15 March 2021

Metabolite XTP

  • common-name:
    • xtp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
  • inchi-key:
    • caefewvyezabla-uuokfmhzsa-j
  • molecular-weight:
    • 520.136

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality