Difference between revisions of "L-arginyl-L-Glutamyl-Peptides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17320 == * transcription-direction: ** negative * right-end-position: ** 195145 * left-end-position: ** 184636 * centisome-position: ** 69.91246...")
(Created page with "Category:metabolite == Metabolite DUDP == * common-name: ** dudp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** qhwztvccbmii...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17320 ==
+
== Metabolite DUDP ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** dudp
−
* right-end-position:
+
* smiles:
−
** 195145
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
−
* left-end-position:
+
* inchi-key:
−
** 184636
+
** qhwztvccbmiike-shyzeuofsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 69.91246   
+
** 385.14
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ATDUD]]
−
== Reaction(s) associated ==
+
* [[ATDUDm]]
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[DUDPKIN-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-14220]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[F16BDEPHOS-RXN]]
+
* [[DUDT]]
−
** Category: [[annotation]]
+
* [[DUTCP]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DUTUP]]
−
** Category: [[orthology]]
+
* [[RXN-14219]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN0-722]]
−
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
+
* [[UDPREDUCT-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=dudp}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=385.14}}
−
* [[SUGAR-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[P185-PWY]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY66-399]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[SUCSYN-PWY]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[CALVIN-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[GLUCONEO-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-5484]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[GLYCOLYSIS]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=195145}}
 
−
{{#set: left-end-position=184636}}
 
−
{{#set: centisome-position=69.91246    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=7}}
 

Revision as of 20:32, 18 December 2020

Metabolite DUDP

  • common-name:
    • dudp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • qhwztvccbmiike-shyzeuofsa-k
  • molecular-weight:
    • 385.14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-arginyl-L-Glutamyl-Peptides&oldid=46521"