Difference between revisions of "L-aspartyl-tRNAAsn"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == * common-name: ** 5-hydroxyindole acetaldehyde * smiles: ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite L-aspartyl-tRNAAsn == * common-name: ** an l-aspartyl-[trnaasn] == Reaction(s) known to consume the compound == * 6.3.5.6-RXN == Reac...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE ==
+
== Metabolite L-aspartyl-tRNAAsn ==
 
* common-name:
 
* common-name:
** 5-hydroxyindole acetaldehyde
+
** an l-aspartyl-[trnaasn]
* smiles:
 
** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o))
 
* inchi-key:
 
** obfapciusyhfie-uhfffaoysa-n
 
* molecular-weight:
 
** 175.187
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10780]]
+
* [[6.3.5.6-RXN]]
* [[RXN-10781]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10778]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxyindole acetaldehyde}}
+
{{#set: common-name=an l-aspartyl-[trnaasn]}}
{{#set: inchi-key=inchikey=obfapciusyhfie-uhfffaoysa-n}}
 
{{#set: molecular-weight=175.187}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite L-aspartyl-tRNAAsn

  • common-name:
    • an l-aspartyl-[trnaasn]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasn" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.