Difference between revisions of "L-aspartyl-tRNAAsn"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == * common-name: ** 5-hydroxyindole acetaldehyde * smiles: ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite L-aspartyl-tRNAAsn == * common-name: ** an l-aspartyl-[trnaasn] == Reaction(s) known to consume the compound == * 6.3.5.6-RXN == Reac...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-aspartyl-tRNAAsn == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-aspartyl-[trnaasn] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[6.3.5.6-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-aspartyl-[trnaasn]}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite L-aspartyl-tRNAAsn
- common-name:
- an l-aspartyl-[trnaasn]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasn" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.