Difference between revisions of "L-aspartyl-tRNAAsn"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)...")
(Created page with "Category:metabolite == Metabolite L-aspartyl-tRNAAsn == * common-name: ** an l-aspartyl-[trnaasn] == Reaction(s) known to consume the compound == * 6.3.5.6-RXN == Reac...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ ==
+
== Metabolite L-aspartyl-tRNAAsn ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
+
** an l-aspartyl-[trnaasn]
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
 
* inchi-key:
 
** atqqulxelmejix-nsuijkaqsa-n
 
* molecular-weight:
 
** 562.874
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[6.3.5.6-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-54]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=an l-aspartyl-[trnaasn]}}
{{#set: inchi-key=inchikey=atqqulxelmejix-nsuijkaqsa-n}}
 
{{#set: molecular-weight=562.874}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite L-aspartyl-tRNAAsn

  • common-name:
    • an l-aspartyl-[trnaasn]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasn" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.