Difference between revisions of "L-aspartyl-tRNAAsn"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16618 == * common-name: ** l-malic semialdehyde * smiles: ** c(c(=o)[o-])c(o)[ch]=o * inchi-key: ** qwhdxiuuxwgqme-gsvougtgsa-m * mol...") |
(Created page with "Category:metabolite == Metabolite CPD-19167 == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19167 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-(7z)-hexadecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** c(c(=o)[o-])c(o)[ | + | ** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bucifqoxnyheoo-ydggzukgsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1013.883 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17782]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17781]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-(7z)-hexadecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bucifqoxnyheoo-ydggzukgsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1013.883}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-19167
- common-name:
- 3-oxo-(7z)-hexadecenoyl-coa
- smiles:
- ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- bucifqoxnyheoo-ydggzukgsa-j
- molecular-weight:
- 1013.883
