Difference between revisions of "L-fucose-protein-serine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite L-fucose-protein-serine == * common-name: ** a [protein]-3-o-l-fucosyl-l-serine == Reaction(s) known to consume the compound == * 2.4.1...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19158 ==
+
== Metabolite L-fucose-protein-serine ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-hexadecenoyl-coa
+
** a [protein]-3-o-l-fucosyl-l-serine
* smiles:
 
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jdnargywmlyada-mdmkaecgsa-j
 
* molecular-weight:
 
** 1013.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17791]]
+
* [[2.4.1.221-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17790]]
+
* [[2.4.1.221-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
+
{{#set: common-name=a [protein]-3-o-l-fucosyl-l-serine}}
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
 
{{#set: molecular-weight=1013.883}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite L-fucose-protein-serine

  • common-name:
    • a [protein]-3-o-l-fucosyl-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-l-fucosyl-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.