Difference between revisions of "L-glutamyl-tRNAGln"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-134 == * common-name: ** gibberellin a9 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o))) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9957 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinol-9 |
* smiles: | * smiles: | ||
| − | ** c= | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** npcoqxavbjjzbq-wjnluyjisa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 797.255 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.1.1.64-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ubiquinol-9}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=797.255}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-9957
- common-name:
- ubiquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
- inchi-key:
- npcoqxavbjjzbq-wjnluyjisa-n
- molecular-weight:
- 797.255
