Difference between revisions of "L-glutamyl-tRNAGln"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...")
(Created page with "Category:metabolite == Metabolite L-glutamyl-tRNAGln == * common-name: ** an l-glutamyl-[trnagln] == Reaction(s) known to consume the compound == * 6.3.5.7-RXN == Reac...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9957 ==
+
== Metabolite L-glutamyl-tRNAGln ==
 
* common-name:
 
* common-name:
** ubiquinol-9
+
** an l-glutamyl-[trnagln]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
** npcoqxavbjjzbq-wjnluyjisa-n
 
* molecular-weight:
 
** 797.255
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[6.3.5.7-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.64-RXN]]
+
* [[RXN-9386]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-9}}
+
{{#set: common-name=an l-glutamyl-[trnagln]}}
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
 
{{#set: molecular-weight=797.255}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite L-glutamyl-tRNAGln

  • common-name:
    • an l-glutamyl-[trnagln]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-glutamyl-[trnagln" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.