Difference between revisions of "L-methionyl-L-alanyl-Protein"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17313 == * common-name: ** sapienoyl-coa * smiles: ** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
(Created page with "Category:metabolite == Metabolite Sugar == * common-name: ** a sugar == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * SU...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17313 ==
+
== Metabolite Sugar ==
 
* common-name:
 
* common-name:
** sapienoyl-coa
+
** a sugar
* smiles:
 
** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** pvzuhjmomjkuef-hatlacbzsa-j
 
* molecular-weight:
 
** 999.899
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16065]]
+
* [[SUGAR-PHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sapienoyl-coa}}
+
{{#set: common-name=a sugar}}
{{#set: inchi-key=inchikey=pvzuhjmomjkuef-hatlacbzsa-j}}
 
{{#set: molecular-weight=999.899}}
 

Revision as of 13:09, 14 January 2021

Metabolite Sugar

  • common-name:
    • a sugar

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality