Difference between revisions of "L-methionyl-tRNAfmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-237 == * common-name: ** (indol-3-yl)acetamide * smiles: ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** zoambxdogprzlp-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite SUCC-S-ALD == * common-name: ** succinate semialdehyde * smiles: ** c([ch]=o)cc(=o)[o-] * inchi-key: ** uiujiqzeacwqsv-uhfffaoysa-m * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SUCC-S-ALD == |
* common-name: | * common-name: | ||
− | ** | + | ** succinate semialdehyde |
* smiles: | * smiles: | ||
− | ** c( | + | ** c([ch]=o)cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uiujiqzeacwqsv-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 101.082 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GABATRANSAM-RXN]] |
+ | * [[RXN-14146]] | ||
+ | * [[RXN0-5293]] | ||
+ | * [[SSNOm]] | ||
+ | * [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
+ | * [[SUCCSEMIALDDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]] |
+ | * [[GABATRANSAM-RXN]] | ||
+ | * [[RXN-14146]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=succinate semialdehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uiujiqzeacwqsv-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=101.082}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite SUCC-S-ALD
- common-name:
- succinate semialdehyde
- smiles:
- c([ch]=o)cc(=o)[o-]
- inchi-key:
- uiujiqzeacwqsv-uhfffaoysa-m
- molecular-weight:
- 101.082
Reaction(s) known to consume the compound
- GABATRANSAM-RXN
- RXN-14146
- RXN0-5293
- SSNOm
- SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN
- SUCCSEMIALDDEHYDROG-RXN