Difference between revisions of "L-methionyl-tRNAfmet"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9007 == * common-name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o...")
(Created page with "Category:metabolite == Metabolite L-methionyl-tRNAfmet == * common-name: ** an l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compound == * METHIONY...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9007 ==
+
== Metabolite L-methionyl-tRNAfmet ==
 
* common-name:
 
* common-name:
** adp ribose 1'',2''-cyclic phosphate
+
** an l-methionyl-[initiator trnamet]
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
 
* inchi-key:
 
** npspryxpogpcpm-tyasjmozsa-k
 
* molecular-weight:
 
** 618.26
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.160-RXN]]
+
* [[RXN-16165]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adp ribose 1'',2''-cyclic phosphate}}
+
{{#set: common-name=an l-methionyl-[initiator trnamet]}}
{{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}}
 
{{#set: molecular-weight=618.26}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite L-methionyl-tRNAfmet

  • common-name:
    • an l-methionyl-[initiator trnamet]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-methionyl-[initiator trnamet" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.