Difference between revisions of "L-methionyl-tRNAfmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite L-methionyl-tRNAfmet == * common-name: ** an l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compound == * METHIONY...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-methionyl-tRNAfmet == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-methionyl-[initiator trnamet] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16165]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-methionyl-[initiator trnamet]}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite L-methionyl-tRNAfmet
- common-name:
- an l-methionyl-[initiator trnamet]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-methionyl-[initiator trnamet" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.