Difference between revisions of "L-seryl-SEC-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14133 == * common-name: ** (r)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=...")
(Created page with "Category:metabolite == Metabolite ETOH == * common-name: ** ethanol * smiles: ** cco * inchi-key: ** lfqscwfljhtthz-uhfffaoysa-n * molecular-weight: ** 46.069 == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14133 ==
+
== Metabolite ETOH ==
 
* common-name:
 
* common-name:
** (r)-nadphx
+
** ethanol
 
* smiles:
 
* smiles:
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
+
** cco
 
* inchi-key:
 
* inchi-key:
** szkxtjuokargiy-mtkbybfrsa-j
+
** lfqscwfljhtthz-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 759.41
+
** 46.069
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13142]]
+
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[RXN-12639]]
 +
* [[RXN66-1]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALCDH_LPAREN_nadp_RPAREN_hi]]
 +
* [[ALCDH_LPAREN_nadp_RPAREN_i]]
 +
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[RXN-12484]]
 +
* [[RXN-8748]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-nadphx}}
+
{{#set: common-name=ethanol}}
{{#set: inchi-key=inchikey=szkxtjuokargiy-mtkbybfrsa-j}}
+
{{#set: inchi-key=inchikey=lfqscwfljhtthz-uhfffaoysa-n}}
{{#set: molecular-weight=759.41}}
+
{{#set: molecular-weight=46.069}}

Revision as of 14:57, 5 January 2021

Metabolite ETOH

  • common-name:
    • ethanol
  • smiles:
    • cco
  • inchi-key:
    • lfqscwfljhtthz-uhfffaoysa-n
  • molecular-weight:
    • 46.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality