Difference between revisions of "L-seryl-SEC-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...") |
(Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** ybisuhxejdgad...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPDQT-38 == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** 3-[(5'-methylthio)pentyl]malate |
* smiles: | * smiles: | ||
− | ** | + | ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ybisuhxejdgadq-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 248.293 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-18204]] | ||
+ | * [[RXNQT-4171]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-18204]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=3-[(5'-methylthio)pentyl]malate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ybisuhxejdgadq-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=248.293}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite CPDQT-38
- common-name:
- 3-[(5'-methylthio)pentyl]malate
- smiles:
- cscccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- ybisuhxejdgadq-uhfffaoysa-l
- molecular-weight:
- 248.293
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(5'-methylthio)pentyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.