Difference between revisions of "LACTOSECAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)...")
(Created page with "Category:pathway == Pathway LACTOSECAT-PWY == * taxonomic-range: ** tax-1239 * common-name: ** lactose and galactose degradation i == Reaction(s) found == * TAGAALDOL-RX...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] ==
+
== Pathway LACTOSECAT-PWY ==
 +
* taxonomic-range:
 +
** tax-1239
 
* common-name:
 
* common-name:
** (3r)-hydroxy-undecanoyl-coa
+
** lactose and galactose degradation i
* smiles:
+
== Reaction(s) found ==
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[TAGAALDOL-RXN]]
* inchi-key:
+
* [[TAGAKIN-RXN]]
** jiogxinzsoqege-mawalykisa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneLACTOSE6P-HYDROXY-RXN LACTOSE6P-HYDROXY-RXN]
** 947.78
+
* [NoneLACTOSE-6-PHOSPHATE-ISOMERASE-RXN LACTOSE-6-PHOSPHATE-ISOMERASE-RXN]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-1239}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=lactose and galactose degradation i}}
* [[RXN-14778]]
+
{{#set: nb reaction found=2}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.5}}
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
 
{{#set: molecular-weight=947.78}}
 

Latest revision as of 10:58, 18 March 2021

Pathway LACTOSECAT-PWY

  • taxonomic-range:
    • tax-1239
  • common-name:
    • lactose and galactose degradation i

Reaction(s) found

Reaction(s) not found

  • [NoneLACTOSE6P-HYDROXY-RXN LACTOSE6P-HYDROXY-RXN]
  • [NoneLACTOSE-6-PHOSPHATE-ISOMERASE-RXN LACTOSE-6-PHOSPHATE-ISOMERASE-RXN]