Difference between revisions of "LACTOSECAT-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] ==
+== Pathway LACTOSECAT-PWY ==
+* taxonomic-range:
+** tax-1239
 * common-name:
-** 3,4-dihydroxymandelate
+** lactose and galactose degradation i
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
+* [[TAGAALDOL-RXN]]
-* inchi-key:
+* [[TAGAKIN-RXN]]
-** rghmisiykihajw-ssdottswsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneLACTOSE6P-HYDROXY-RXN LACTOSE6P-HYDROXY-RXN]
-** 183.14
+* [NoneLACTOSE-6-PHOSPHATE-ISOMERASE-RXN LACTOSE-6-PHOSPHATE-ISOMERASE-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-1239}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=lactose and galactose degradation i}}
-* [[RXN-10912]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=3,4-dihydroxymandelate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}}
-{{#set: molecular-weight=183.14}}