Difference between revisions of "LACTOSECAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-undecanoyl-coa
+
** 3,4-dihydroxymandelate
 
* smiles:
 
* smiles:
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
 
* inchi-key:
 
* inchi-key:
** jiogxinzsoqege-mawalykisa-j
+
** rghmisiykihajw-ssdottswsa-m
 
* molecular-weight:
 
* molecular-weight:
** 947.78
+
** 183.14
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14778]]
+
* [[RXN-10912]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
+
{{#set: common-name=3,4-dihydroxymandelate}}
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
+
{{#set: inchi-key=inchikey=rghmisiykihajw-ssdottswsa-m}}
{{#set: molecular-weight=947.78}}
+
{{#set: molecular-weight=183.14}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-11879

  • common-name:
    • 3,4-dihydroxymandelate
  • smiles:
    • c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o
  • inchi-key:
    • rghmisiykihajw-ssdottswsa-m
  • molecular-weight:
    • 183.14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality