Difference between revisions of "LACTOSEUTIL-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIACYLGLYCEROL DIACYLGLYCEROL] == * common-name: ** a 1,2-diacyl-sn-glycerol == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13398 CPD-13398] == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13398 CPD-13398] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-leucine |
| + | * smiles: | ||
| + | ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o | ||
| + | * inchi-key: | ||
| + | ** rdikfprvljlmer-bqbzgakwsa-n | ||
| + | * molecular-weight: | ||
| + | ** 202.253 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6979]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-leucine}} |
| + | {{#set: inchi-key=inchikey=rdikfprvljlmer-bqbzgakwsa-n}} | ||
| + | {{#set: molecular-weight=202.253}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-13398
- common-name:
- l-alanyl-l-leucine
- smiles:
- cc(c)cc(c([o-])=o)nc(c(c)[n+])=o
- inchi-key:
- rdikfprvljlmer-bqbzgakwsa-n
- molecular-weight:
- 202.253
