Difference between revisions of "LANOSTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OXALATE == * common-name: ** oxalate * smiles: ** c([o-])(c(=o)[o-])=o * inchi-key: ** mubzpkhoepujkr-uhfffaoysa-l * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite CPD-7002 == * common-name: ** dihydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7002 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydrogeranylgeranyl diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yjganofpasczbk-wcnzlwbosa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 449.44 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7658]] |
| + | * [[RXN-7659]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7658]] |
| + | * [[RXN-7659]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrogeranylgeranyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=449.44}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-7002
- common-name:
- dihydrogeranylgeranyl diphosphate
- smiles:
- cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- yjganofpasczbk-wcnzlwbosa-k
- molecular-weight:
- 449.44
