Difference between revisions of "LANOSTEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7002 == * common-name: ** dihydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c...")
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7002 ==
+
== Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P ==
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl diphosphate
+
** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
+
** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** yjganofpasczbk-wcnzlwbosa-k
+
** uphpwxpnziozjl-kxxvrosksa-a
 
* molecular-weight:
 
* molecular-weight:
** 449.44
+
** 726.913
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7658]]
+
* [[2.7.4.24-RXN]]
* [[RXN-7659]]
+
* [[RXN-10964]]
 +
* [[RXN-10965]]
 +
* [[RXN-10979]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7658]]
+
* [[2.7.1.152-RXN]]
* [[RXN-7659]]
+
* [[RXN-10965]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
{{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}}
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}
{{#set: molecular-weight=449.44}}
+
{{#set: molecular-weight=726.913}}

Revision as of 08:26, 15 March 2021

Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P

  • common-name:
    • 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
  • smiles:
    • c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • uphpwxpnziozjl-kxxvrosksa-a
  • molecular-weight:
    • 726.913

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality