Difference between revisions of "LANOSTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NN-dimethyl-terminal-PPK == * common-name: ** an n terminal n,n-dimethyl-ppk-[protein] == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite CPD-9896 == * common-name: ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9896 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate |
| + | * smiles: | ||
| + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** fmsczymouyoenk-opsrswoasa-m | ||
| + | * molecular-weight: | ||
| + | ** 766.178 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}} |
| + | {{#set: inchi-key=inchikey=fmsczymouyoenk-opsrswoasa-m}} | ||
| + | {{#set: molecular-weight=766.178}} | ||
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-9896
- common-name:
- 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
- inchi-key:
- fmsczymouyoenk-opsrswoasa-m
- molecular-weight:
- 766.178
