Difference between revisions of "LANOSTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1081 == * common-name: ** 5α-cholestan-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34)))...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-FERULIC-ACID == * common-name: ** 5-hydroxyferulate * smiles: ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) * inchi-key: ** yfxwtvldsk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXY-FERULIC-ACID == |
* common-name: | * common-name: | ||
| − | ** 5 | + | ** 5-hydroxyferulate |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yfxwtvldsksylw-nscuhmnnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 209.178 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-3422]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1121]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=5 | + | {{#set: common-name=5-hydroxyferulate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yfxwtvldsksylw-nscuhmnnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=209.178}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite 5-HYDROXY-FERULIC-ACID
- common-name:
- 5-hydroxyferulate
- smiles:
- coc1(c=c(c=cc([o-])=o)c=c(o)c(o)=1)
- inchi-key:
- yfxwtvldsksylw-nscuhmnnsa-m
- molecular-weight:
- 209.178
