Difference between revisions of "LC-alcohol-LC-acyl-ester"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LC-alcohol-LC-acyl-ester == * common-name: ** a long-chain alcohol--long-chain acyl wax ester == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite CPD-15036 == * common-name: ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate * smiles: ** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-] * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LC-alcohol-LC-acyl-ester ==
+
== Metabolite CPD-15036 ==
 
* common-name:
 
* common-name:
** a long-chain alcohol--long-chain acyl wax ester
+
** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate
 +
* smiles:
 +
** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-]
 +
* inchi-key:
 +
** wfkzeqzrfipkif-ucorvyfpsa-l
 +
* molecular-weight:
 +
** 254.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.75-RXN]]
+
* [[RXN-14021]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a long-chain alcohol--long-chain acyl wax ester}}
+
{{#set: common-name=5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate}}
 +
{{#set: inchi-key=inchikey=wfkzeqzrfipkif-ucorvyfpsa-l}}
 +
{{#set: molecular-weight=254.168}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-15036

  • common-name:
    • 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate
  • smiles:
    • c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-]
  • inchi-key:
    • wfkzeqzrfipkif-ucorvyfpsa-l
  • molecular-weight:
    • 254.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality