Difference between revisions of "LEU"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12458 RXN-12458] == * direction: ** left-to-right * common-name: ** trna m1g37 methyltransferas...")
(Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** wosy...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12458 RXN-12458] ==
+
== Metabolite CPD-14596 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna m1g37 methyltransferase
+
** neolinustatin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.228 ec-2.1.1.228]
+
** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Guanine37-in-tRNA]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-N1-Methylguanine-37]][c]
+
** wosyvgndrybqcq-bargltkpsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00719]]
+
** 423.416
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13603]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=neolinustatin}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=wosyvgndrybqcq-bargltkpsa-n}}
−
* RHEA:
+
{{#set: molecular-weight=423.416}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=36900 36900]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00597 R00597]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna m1g37 methyltransferase}}
 
−
{{#set: ec-number=ec-2.1.1.228}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-14596

  • common-name:
    • neolinustatin
  • smiles:
    • ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
  • inchi-key:
    • wosyvgndrybqcq-bargltkpsa-n
  • molecular-weight:
    • 423.416

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=LEU&oldid=47708"