Difference between revisions of "LEU-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Proteins-L-Threonines == * common-name: ** a [protein]-l-threonine == Reaction(s) known to consume the compound == * RXN-11890 * RX...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE-5P == * common-name: ** pyridoxamine 5'-phosphate * smiles: ** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o) * inchi-key: ** z...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PYRIDOXAMINE-5P == |
* common-name: | * common-name: | ||
− | ** | + | ** pyridoxamine 5'-phosphate |
+ | * smiles: | ||
+ | ** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o) | ||
+ | * inchi-key: | ||
+ | ** zmjgsosnspkhnh-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 247.167 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[PMPOXI-RXN]] |
− | * [[RXN- | + | * [[PYAMPP]] |
+ | * [[RXN-14046]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PYRAMKIN-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pyridoxamine 5'-phosphate}} |
+ | {{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=247.167}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite PYRIDOXAMINE-5P
- common-name:
- pyridoxamine 5'-phosphate
- smiles:
- cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
- inchi-key:
- zmjgsosnspkhnh-uhfffaoysa-m
- molecular-weight:
- 247.167