Difference between revisions of "LEUCOPELARGONIDIN-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-Methoxy-6-polyprenyl-phenols == * common-name: ** a 2-methoxy-6-(all-trans-polyprenyl)phenol == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LEUCOPELARGONIDIN-CMPD == |
* common-name: | * common-name: | ||
− | ** | + | ** (2r,3s,4s)-leucopelargonidin |
+ | * smiles: | ||
+ | ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) | ||
+ | * inchi-key: | ||
+ | ** fsvmlwolzhgcqx-souvjxgzsa-n | ||
+ | * molecular-weight: | ||
+ | ** 290.272 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2r,3s,4s)-leucopelargonidin}} |
+ | {{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}} | ||
+ | {{#set: molecular-weight=290.272}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite LEUCOPELARGONIDIN-CMPD
- common-name:
- (2r,3s,4s)-leucopelargonidin
- smiles:
- c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
- inchi-key:
- fsvmlwolzhgcqx-souvjxgzsa-n
- molecular-weight:
- 290.272