Difference between revisions of "LEUCOPELARGONIDIN-CMPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-Methoxy-6-polyprenyl-phenols == * common-name: ** a 2-methoxy-6-(all-trans-polyprenyl)phenol == Reaction(s) known to consume the compou...")
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-Methoxy-6-polyprenyl-phenols ==
+
== Metabolite LEUCOPELARGONIDIN-CMPD ==
 
* common-name:
 
* common-name:
** a 2-methoxy-6-(all-trans-polyprenyl)phenol
+
** (2r,3s,4s)-leucopelargonidin
 +
* smiles:
 +
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
 +
* inchi-key:
 +
** fsvmlwolzhgcqx-souvjxgzsa-n
 +
* molecular-weight:
 +
** 290.272
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12160]]
+
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-methoxy-6-(all-trans-polyprenyl)phenol}}
+
{{#set: common-name=(2r,3s,4s)-leucopelargonidin}}
 +
{{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}}
 +
{{#set: molecular-weight=290.272}}

Latest revision as of 11:15, 18 March 2021

Metabolite LEUCOPELARGONIDIN-CMPD

  • common-name:
    • (2r,3s,4s)-leucopelargonidin
  • smiles:
    • c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
  • inchi-key:
    • fsvmlwolzhgcqx-souvjxgzsa-n
  • molecular-weight:
    • 290.272

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality