Difference between revisions of "LINAMARIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Thiols == * common-name: ** a thiol == Reaction(s) known to consume the compound == * THIOL-S-METHYLTRANSFERASE-RXN == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Thiols ==
+
== Metabolite LINAMARIN ==
 
* common-name:
 
* common-name:
** a thiol
+
** linamarin
 +
* smiles:
 +
** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** qltchmyaejexbt-zebdfxrssa-n
 +
* molecular-weight:
 +
** 247.247
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THIOL-S-METHYLTRANSFERASE-RXN]]
+
* [[RXN-5341]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15582]]
+
* [[RXN-13602]]
* [[RXN-6763]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a thiol}}
+
{{#set: common-name=linamarin}}
 +
{{#set: inchi-key=inchikey=qltchmyaejexbt-zebdfxrssa-n}}
 +
{{#set: molecular-weight=247.247}}

Latest revision as of 11:11, 18 March 2021

Metabolite LINAMARIN

  • common-name:
    • linamarin
  • smiles:
    • cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
  • inchi-key:
    • qltchmyaejexbt-zebdfxrssa-n
  • molecular-weight:
    • 247.247

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality