Difference between revisions of "LINOLEIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-387 == * common-name: ** iodide * smiles: ** [i-] * inchi-key: ** xmbwdfgmswqbca-uhfffaoysa-m * molecular-weight: ** 126.904 == React...") |
(Created page with "Category:metabolite == Metabolite LINOLEIC_ACID == * common-name: ** linoleate * smiles: ** cccccc=ccc=ccccccccc([o-])=o * inchi-key: ** oyhqolukzrvurq-hzjyttrnsa-m * mole...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LINOLEIC_ACID == |
* common-name: | * common-name: | ||
− | ** | + | ** linoleate |
* smiles: | * smiles: | ||
− | ** [ | + | ** cccccc=ccc=ccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oyhqolukzrvurq-hzjyttrnsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 279.442 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[LIPOXYGENASE-RXN]] |
+ | * [[LNLCCOAL]] | ||
+ | * [[RXN-9673]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[FACOAE182]] | ||
+ | * [[LINOLEOYL-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=linoleate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oyhqolukzrvurq-hzjyttrnsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=279.442}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite LINOLEIC_ACID
- common-name:
- linoleate
- smiles:
- cccccc=ccc=ccccccccc([o-])=o
- inchi-key:
- oyhqolukzrvurq-hzjyttrnsa-m
- molecular-weight:
- 279.442