Difference between revisions of "LINOLEIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10116 == * transcription-direction: ** positive * right-end-position: ** 29143 * left-end-position: ** 19264 * centisome-position: ** 4.851574...")
(Created page with "Category:metabolite == Metabolite LINOLEIC_ACID == * common-name: ** linoleate * smiles: ** cccccc=ccc=ccccccccc([o-])=o * inchi-key: ** oyhqolukzrvurq-hzjyttrnsa-m * mole...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10116 ==
+
== Metabolite LINOLEIC_ACID ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** linoleate
−
* right-end-position:
+
* smiles:
−
** 29143
+
** cccccc=ccc=ccccccccc([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 19264
+
** oyhqolukzrvurq-hzjyttrnsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 4.851574   
+
** 279.442
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[LIPOXYGENASE-RXN]]
−
== Reaction(s) associated ==
+
* [[LNLCCOAL]]
−
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
+
* [[RXN-9673]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[FACOAE182]]
−
* [[RXN-13404]]
+
* [[LINOLEOYL-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=linoleate}}
−
* [[RXN-13405]]
+
{{#set: inchi-key=inchikey=oyhqolukzrvurq-hzjyttrnsa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=279.442}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13406]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-9679]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-9680]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[P541-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6004]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=29143}}
 
−
{{#set: left-end-position=19264}}
 
−
{{#set: centisome-position=4.851574    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite LINOLEIC_ACID

  • common-name:
    • linoleate
  • smiles:
    • cccccc=ccc=ccccccccc([o-])=o
  • inchi-key:
    • oyhqolukzrvurq-hzjyttrnsa-m
  • molecular-weight:
    • 279.442

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=LINOLEIC_ACID&oldid=137272"