Difference between revisions of "LINOLEIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18748 == * transcription-direction: ** negative * right-end-position: ** 237866 * left-end-position: ** 233952 * centisome-position: ** 98.31982...") |
(Created page with "Category:metabolite == Metabolite LINOLEIC_ACID == * common-name: ** linoleate * smiles: ** cccccc=ccc=ccccccccc([o-])=o * inchi-key: ** oyhqolukzrvurq-hzjyttrnsa-m * mole...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite LINOLEIC_ACID == |
| − | * | + | * common-name: |
| − | ** | + | ** linoleate |
| − | * | + | * smiles: |
| − | ** | + | ** cccccc=ccc=ccccccccc([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** oyhqolukzrvurq-hzjyttrnsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 279.442 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[LIPOXYGENASE-RXN]] |
| − | == Reaction(s) | + | * [[LNLCCOAL]] |
| − | * [[ | + | * [[RXN-9673]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[FACOAE182]] | |
| − | {{#set: | + | * [[LINOLEOYL-RXN]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=linoleate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=oyhqolukzrvurq-hzjyttrnsa-m}} |
| − | + | {{#set: molecular-weight=279.442}} | |
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite LINOLEIC_ACID
- common-name:
- linoleate
- smiles:
- cccccc=ccc=ccccccccc([o-])=o
- inchi-key:
- oyhqolukzrvurq-hzjyttrnsa-m
- molecular-weight:
- 279.442
