Difference between revisions of "LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-126 == * common-name: ** γ-carotene * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c * i...") |
(Created page with "Category:metabolite == Metabolite Seminolipids == * common-name: ** a seminolipid == Reaction(s) known to consume the compound == * RXN-17203 == Reaction(s) known to p...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Seminolipids == |
* common-name: | * common-name: | ||
− | ** | + | ** a seminolipid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17203]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17203]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a seminolipid}} |
− | |||
− |
Revision as of 11:16, 15 January 2021
Contents
Metabolite Seminolipids
- common-name:
- a seminolipid