Difference between revisions of "LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9096 == * common-name: ** bacteriopheophytin a * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cc...") |
(Created page with "Category:metabolite == Metabolite LINOLENOYL-COA == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-]...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LINOLENOYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** α-linolenoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** omkfkbgzhnjnex-kzwmewpfsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1023.921 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13426]] | ||
+ | * [[RXN-13441]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[LINOLENOYL-RXN]] |
− | * [[ | + | * [[LNLNCACOAL]] |
+ | * [[llcoas]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-linolenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1023.921}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite LINOLENOYL-COA
- common-name:
- α-linolenoyl-coa
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
- inchi-key:
- omkfkbgzhnjnex-kzwmewpfsa-j
- molecular-weight:
- 1023.921