Difference between revisions of "LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07259 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite LINOLENOYL-COA == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-]...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite LINOLENOYL-COA == |
− | == | + | * common-name: |
− | + | ** α-linolenoyl-coa | |
− | == | + | * smiles: |
− | + | ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3) | |
− | ** | + | * inchi-key: |
− | *** | + | ** omkfkbgzhnjnex-kzwmewpfsa-j |
− | * [[RXN- | + | * molecular-weight: |
− | * | + | ** 1023.921 |
− | * | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[RXN-13426]] |
− | + | * [[RXN-13441]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | * [[LINOLENOYL-RXN]] |
− | {{#set: | + | * [[LNLNCACOAL]] |
− | {{#set: | + | * [[llcoas]] |
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=α-linolenoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}} | ||
+ | {{#set: molecular-weight=1023.921}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite LINOLENOYL-COA
- common-name:
- α-linolenoyl-coa
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
- inchi-key:
- omkfkbgzhnjnex-kzwmewpfsa-j
- molecular-weight:
- 1023.921