Difference between revisions of "LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Seminolipids == * common-name: ** a seminolipid == Reaction(s) known to consume the compound == * RXN-17203 == Reaction(s) known to p...") |
(Created page with "Category:metabolite == Metabolite CPD-6741 == * common-name: ** d-myo-inositol (1,2,3,5,6) pentakisphosphate * smiles: ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-6741 == |
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol (1,2,3,5,6) pentakisphosphate |
+ | * smiles: | ||
+ | ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | ||
+ | * inchi-key: | ||
+ | ** ctpqaxvnygzuaj-uotptpdrsa-d | ||
+ | * molecular-weight: | ||
+ | ** 569.977 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7241]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (1,2,3,5,6) pentakisphosphate}} |
+ | {{#set: inchi-key=inchikey=ctpqaxvnygzuaj-uotptpdrsa-d}} | ||
+ | {{#set: molecular-weight=569.977}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite CPD-6741
- common-name:
- d-myo-inositol (1,2,3,5,6) pentakisphosphate
- smiles:
- c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- ctpqaxvnygzuaj-uotptpdrsa-d
- molecular-weight:
- 569.977