Difference between revisions of "LIPAS-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] ==
+== Pathway LIPAS-PWY ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** antheraxanthin
+** triacylglycerol degradation
-* smiles:
+== Reaction(s) found ==
-** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
+* [[3.1.1.23-RXN]]
-* inchi-key:
+* [[TRIACYLGLYCEROL-LIPASE-RXN]]
-** ofnsuwbaqrchav-oyquvcaxsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-7952 RXN-7952]
-** 584.881
+* [NoneRXN-1602 RXN-1602]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-* [[RXN-7979]]
+{{#set: common-name=triacylglycerol degradation}}
-* [[RXN-7985]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-* [[RXN-7978]]
+{{#set: nb total reaction=3}}
-* [[RXN-7984]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=antheraxanthin}}
-{{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}}
-{{#set: molecular-weight=584.881}}