Difference between revisions of "LIPOAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3705 == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o * in...")
(Created page with "Category:metabolite == Metabolite CPD-4617 == * common-name: ** dihydrozeatin-o-glucoside * smiles: ** cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3705 ==
+
== Metabolite CPD-4617 ==
 
* common-name:
 
* common-name:
** adenosine 2'-monophosphate
+
** dihydrozeatin-o-glucoside
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o
+
** cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o)
 
* inchi-key:
 
* inchi-key:
** qdfhpfsbqfllsw-kqynxxcusa-l
+
** qrzhdhjuybonqq-jsymrtrdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 345.208
+
** 383.403
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12057]]
+
* [[RXN-4726]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 2'-monophosphate}}
+
{{#set: common-name=dihydrozeatin-o-glucoside}}
{{#set: inchi-key=inchikey=qdfhpfsbqfllsw-kqynxxcusa-l}}
+
{{#set: inchi-key=inchikey=qrzhdhjuybonqq-jsymrtrdsa-n}}
{{#set: molecular-weight=345.208}}
+
{{#set: molecular-weight=383.403}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-4617

  • common-name:
    • dihydrozeatin-o-glucoside
  • smiles:
    • cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o)
  • inchi-key:
    • qrzhdhjuybonqq-jsymrtrdsa-n
  • molecular-weight:
    • 383.403

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality