Difference between revisions of "LIPOAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3705 == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o * in...")
(Created page with "Category:metabolite == Metabolite LIPOAMIDE == * common-name: ** lipoamide * smiles: ** c1(cc(ccccc(n)=o)ss1) * inchi-key: ** fccddurtiiuxby-ssdottswsa-n * molecular-weigh...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3705 ==
+
== Metabolite LIPOAMIDE ==
 
* common-name:
 
* common-name:
** adenosine 2'-monophosphate
+
** lipoamide
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o
+
** c1(cc(ccccc(n)=o)ss1)
 
* inchi-key:
 
* inchi-key:
** qdfhpfsbqfllsw-kqynxxcusa-l
+
** fccddurtiiuxby-ssdottswsa-n
 
* molecular-weight:
 
* molecular-weight:
** 345.208
+
** 205.333
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AKGDHmi]]
 +
* [[PDHam2hi]]
 +
* [[PDHam2mi]]
 +
* [[PDHe3mr]]
 +
* [[RXN-18331]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12057]]
+
* [[PDHe3mr]]
 +
* [[RXN-18331]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 2'-monophosphate}}
+
{{#set: common-name=lipoamide}}
{{#set: inchi-key=inchikey=qdfhpfsbqfllsw-kqynxxcusa-l}}
+
{{#set: inchi-key=inchikey=fccddurtiiuxby-ssdottswsa-n}}
{{#set: molecular-weight=345.208}}
+
{{#set: molecular-weight=205.333}}

Latest revision as of 11:13, 18 March 2021

Metabolite LIPOAMIDE

  • common-name:
    • lipoamide
  • smiles:
    • c1(cc(ccccc(n)=o)ss1)
  • inchi-key:
    • fccddurtiiuxby-ssdottswsa-n
  • molecular-weight:
    • 205.333

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality