Difference between revisions of "LIPOAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3705 == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o * in...") |
(Created page with "Category:metabolite == Metabolite LIPOAMIDE == * common-name: ** lipoamide * smiles: ** c1(cc(ccccc(n)=o)ss1) * inchi-key: ** fccddurtiiuxby-ssdottswsa-n * molecular-weigh...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LIPOAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** lipoamide |
* smiles: | * smiles: | ||
− | ** | + | ** c1(cc(ccccc(n)=o)ss1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fccddurtiiuxby-ssdottswsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 205.333 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[AKGDHmi]] | ||
+ | * [[PDHam2hi]] | ||
+ | * [[PDHam2mi]] | ||
+ | * [[PDHe3mr]] | ||
+ | * [[RXN-18331]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[PDHe3mr]] |
+ | * [[RXN-18331]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=lipoamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fccddurtiiuxby-ssdottswsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=205.333}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite LIPOAMIDE
- common-name:
- lipoamide
- smiles:
- c1(cc(ccccc(n)=o)ss1)
- inchi-key:
- fccddurtiiuxby-ssdottswsa-n
- molecular-weight:
- 205.333