Difference between revisions of "LIPOYL-AMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17283 == * common-name: ** a [glycerolipid]-di-homo-γ-linolenate == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite LIPOYL-AMP == * common-name: ** lipoyl-adenylate * smiles: ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=...")
 
(6 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17283 ==
+
== Metabolite LIPOYL-AMP ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-di-homo-γ-linolenate
+
** lipoyl-adenylate
 +
* smiles:
 +
** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
 +
* inchi-key:
 +
** qwegocjrzoksoe-aduakinbsa-m
 +
* molecular-weight:
 +
** 534.518
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13039]]
 +
* [[RXN-8655]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16044]]
+
* [[RXN-8654]]
* [[RXN-16099]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-di-homo-γ-linolenate}}
+
{{#set: common-name=lipoyl-adenylate}}
 +
{{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}}
 +
{{#set: molecular-weight=534.518}}

Latest revision as of 11:12, 18 March 2021

Metabolite LIPOYL-AMP

  • common-name:
    • lipoyl-adenylate
  • smiles:
    • c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
  • inchi-key:
    • qwegocjrzoksoe-aduakinbsa-m
  • molecular-weight:
    • 534.518

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality