Difference between revisions of "LIPOYL-AMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17283 == * common-name: ** a [glycerolipid]-di-homo-γ-linolenate == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite BENZOYLSUCCINYL-COA == * common-name: ** benzoylsuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17283 ==
+
== Metabolite BENZOYLSUCCINYL-COA ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-di-homo-γ-linolenate
+
** benzoylsuccinyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** sgnpjinsckfitg-ihebcorqsa-i
 +
* molecular-weight:
 +
** 966.676
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16044]]
+
* [[RXN-905]]
* [[RXN-16099]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-di-homo-γ-linolenate}}
+
{{#set: common-name=benzoylsuccinyl-coa}}
 +
{{#set: inchi-key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
 +
{{#set: molecular-weight=966.676}}

Revision as of 14:54, 5 January 2021

Metabolite BENZOYLSUCCINYL-COA

  • common-name:
    • benzoylsuccinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • sgnpjinsckfitg-ihebcorqsa-i
  • molecular-weight:
    • 966.676

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality