Difference between revisions of "LL-DIAMINOPIMELATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2184 == * common-name: ** 1-oleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(oc(=o)cc=cccccccc...") |
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LL-DIAMINOPIMELATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l,l-diaminopimelate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gmkmezvlhjarhf-whfbiakzsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 190.199 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DIAMINOPIMEPIM-RXN]] | ||
+ | * [[RXN-7737]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[DIAMINOPIMEPIM-RXN]] |
+ | * [[RXN-7737]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l,l-diaminopimelate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gmkmezvlhjarhf-whfbiakzsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=190.199}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite LL-DIAMINOPIMELATE
- common-name:
- l,l-diaminopimelate
- smiles:
- c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
- inchi-key:
- gmkmezvlhjarhf-whfbiakzsa-n
- molecular-weight:
- 190.199