Difference between revisions of "LL-DIAMINOPIMELATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Non-Glycosylated-sugar-Acceptors == * common-name: ** a non glycosylated sugar acceptor == Reaction(s) known to consume the compound == =...") |
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LL-DIAMINOPIMELATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l,l-diaminopimelate |
| + | * smiles: | ||
| + | ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o | ||
| + | * inchi-key: | ||
| + | ** gmkmezvlhjarhf-whfbiakzsa-n | ||
| + | * molecular-weight: | ||
| + | ** 190.199 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DIAMINOPIMEPIM-RXN]] | ||
| + | * [[RXN-7737]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIAMINOPIMEPIM-RXN]] |
| + | * [[RXN-7737]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l,l-diaminopimelate}} |
| + | {{#set: inchi-key=inchikey=gmkmezvlhjarhf-whfbiakzsa-n}} | ||
| + | {{#set: molecular-weight=190.199}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite LL-DIAMINOPIMELATE
- common-name:
- l,l-diaminopimelate
- smiles:
- c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
- inchi-key:
- gmkmezvlhjarhf-whfbiakzsa-n
- molecular-weight:
- 190.199
