Difference between revisions of "LONG-CHAIN-KETONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...") |
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ITP == |
* common-name: | * common-name: | ||
− | ** | + | ** itp |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** haejpqiatwhalx-kqynxxcusa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 504.137 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ATP-DEAMINASE-RXN]] |
+ | * [[ITCY]] | ||
+ | * [[ITPP]] | ||
+ | * [[ITUP]] | ||
+ | * [[RXN-14120]] | ||
+ | * [[RXN0-5073]] | ||
+ | * [[RXN0-6382]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ATID]] | ||
+ | * [[ATIDm]] | ||
+ | * [[ATP-DEAMINASE-RXN]] | ||
+ | * [[RXN-14120]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=itp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=504.137}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite ITP
- common-name:
- itp
- smiles:
- c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- haejpqiatwhalx-kqynxxcusa-j
- molecular-weight:
- 504.137