Difference between revisions of "LONG-CHAIN-KETONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...") |
(Created page with "Category:metabolite == Metabolite LONG-CHAIN-KETONE == * common-name: ** a ketone == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-RXN * RX...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LONG-CHAIN-KETONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a ketone |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] |
| + | * [[RXN-12267]] | ||
| + | * [[RXN-12448]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] | ||
| + | * [[RXN-12267]] | ||
| + | * [[RXN-12448]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a ketone}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite LONG-CHAIN-KETONE
- common-name:
- a ketone
