Difference between revisions of "LONG-CHAIN-KETONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite LONG-CHAIN-KETONE == * common-name: ** a ketone == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-RXN * RX...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LONG-CHAIN-KETONE == |
* common-name: | * common-name: | ||
− | ** | + | ** a ketone |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] |
− | + | * [[RXN-12267]] | |
− | + | * [[RXN-12448]] | |
− | |||
− | * [[RXN- | ||
− | * [[ | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] |
− | * [[ | + | * [[RXN-12267]] |
− | + | * [[RXN-12448]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a ketone}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite LONG-CHAIN-KETONE
- common-name:
- a ketone