Difference between revisions of "LONG-CHAIN-KETONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
(Created page with "Category:metabolite == Metabolite tRNA-Containing-5AminoMe-2-ThioUrdines == * common-name: ** a 5-aminomethyl-2-thiouridine34 in trna == Reaction(s) known to consume the c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Containing-5AminoMe-2-ThioUrdines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-aminomethyl-2-thiouridine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5144]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-aminomethyl-2-thiouridine34 in trna}} |
| − | |||
| − | |||
Revision as of 15:25, 5 January 2021
Contents
Metabolite tRNA-Containing-5AminoMe-2-ThioUrdines
- common-name:
- a 5-aminomethyl-2-thiouridine34 in trna
