Difference between revisions of "LYS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11241 == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate * smiles: ** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(...")
(Created page with "Category:metabolite == Metabolite UDP-L-ARABINOSE == * common-name: ** udp-l-arabinose == Reaction(s) known to consume the compound == * UA4E == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11241 ==
+
== Metabolite UDP-L-ARABINOSE ==
 
* common-name:
 
* common-name:
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
+
** udp-l-arabinose
* smiles:
 
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
 
* inchi-key:
 
** llvvmxfnkahvez-gawnparcsa-l
 
* molecular-weight:
 
** 350.235
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[UA4E]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14897]]
+
* [[UA4E]]
 +
* [[UMPU]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
+
{{#set: common-name=udp-l-arabinose}}
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
 
{{#set: molecular-weight=350.235}}
 

Revision as of 11:15, 15 January 2021

Metabolite UDP-L-ARABINOSE

  • common-name:
    • udp-l-arabinose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality