Difference between revisions of "LYS2-peptidyl-carrier-protein"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-Pro == * common-name: ** a peptide with an n-terminal l-proline == Reaction(s) known to consume the compound == *...")
(Created page with "Category:metabolite == Metabolite CPD-19153 == * common-name: ** 3-oxo-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-With-N-Terminal-Pro ==
+
== Metabolite CPD-19153 ==
 
* common-name:
 
* common-name:
** a peptide with an n-terminal l-proline
+
** 3-oxo-(5z)-dodecenoyl-coa
 +
* smiles:
 +
** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** vklhslowdwgvgp-cggpsvllsa-j
 +
* molecular-weight:
 +
** 957.775
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.11.5-RXN]]
+
* [[RXN-17799]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.11.1-RXN]]
+
* [[RXN-17798]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a peptide with an n-terminal l-proline}}
+
{{#set: common-name=3-oxo-(5z)-dodecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=vklhslowdwgvgp-cggpsvllsa-j}}
 +
{{#set: molecular-weight=957.775}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-19153

  • common-name:
    • 3-oxo-(5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vklhslowdwgvgp-cggpsvllsa-j
  • molecular-weight:
    • 957.775

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality