Difference between revisions of "LYSINE-AMINOAD-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] == * common-name: ** (+)-dihydrokaempferol * smi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2338 CPD0-2338] == * common-name: ** (z)-3-ureidoacrylate peracid * smiles: ** c(nc(n)=o)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2338 CPD0-2338] ==
 
* common-name:
 
* common-name:
** (+)-dihydrokaempferol
+
** (z)-3-ureidoacrylate peracid
 
* smiles:
 
* smiles:
** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
+
** c(nc(n)=o)=cc(=o)oo
 
* inchi-key:
 
* inchi-key:
** padqinqhpqkxnl-lsdhhaiusa-n
+
** ajfkxwqdhfykfk-uphrsurjsa-n
 
* molecular-weight:
 
* molecular-weight:
** 288.256
+
** 146.102
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* [[RXN-12894]]
* [[RXN1F-93]]
+
* [[RXN0-6460]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-dihydrokaempferol}}
+
{{#set: common-name=(z)-3-ureidoacrylate peracid}}
{{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}}
+
{{#set: inchi-key=inchikey=ajfkxwqdhfykfk-uphrsurjsa-n}}
{{#set: molecular-weight=288.256}}
+
{{#set: molecular-weight=146.102}}

Revision as of 09:22, 27 August 2019

Metabolite CPD0-2338

  • common-name:
    • (z)-3-ureidoacrylate peracid
  • smiles:
    • c(nc(n)=o)=cc(=o)oo
  • inchi-key:
    • ajfkxwqdhfykfk-uphrsurjsa-n
  • molecular-weight:
    • 146.102

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality