Difference between revisions of "LYSOSOMAL-ENZYME-D-MANNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == * common-name: ** (r,s)-tetrahydrobenzylisoquinoline * smiles: ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))...")
(Created page with "Category:metabolite == Metabolite PHENYLACETALDEHYDE == * common-name: ** phenylacetaldehyde * smiles: ** [ch](=o)cc1(=cc=cc=c1) * inchi-key: ** dtuqwgwmvihbke-uhfffaoysa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE ==
+
== Metabolite PHENYLACETALDEHYDE ==
 
* common-name:
 
* common-name:
** (r,s)-tetrahydrobenzylisoquinoline
+
** phenylacetaldehyde
 
* smiles:
 
* smiles:
** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
+
** [ch](=o)cc1(=cc=cc=c1)
 
* inchi-key:
 
* inchi-key:
** yrycifuzsumaay-uhfffaoysa-o
+
** dtuqwgwmvihbke-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 224.325
+
** 120.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.115-RXN]]
+
* [[RXN-7700]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10817]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}}
+
{{#set: common-name=phenylacetaldehyde}}
{{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=dtuqwgwmvihbke-uhfffaoysa-n}}
{{#set: molecular-weight=224.325}}
+
{{#set: molecular-weight=120.151}}

Revision as of 11:19, 15 January 2021

Metabolite PHENYLACETALDEHYDE

  • common-name:
    • phenylacetaldehyde
  • smiles:
    • [ch](=o)cc1(=cc=cc=c1)
  • inchi-key:
    • dtuqwgwmvihbke-uhfffaoysa-n
  • molecular-weight:
    • 120.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality